C20H22F3N5O4S — CID 91970608
1-[2-methoxy-4-(trifluoromethyl)phenyl]-4-oxo-N-pyrimidin-4-yl-2,3,4a,5,6,7,8,8a-octahydro-1H-phthalazine-6-sulfonamide (PubChem CID 91970608) has the molecular formula C20H22F3N5O4S and a molecular weight of 485.49 g/mol. Its IUPAC name is 1-[2-methoxy-4-(trifluoromethyl)phenyl]-4-oxo-N-pyrimidin-4-yl-2,3,4a,5,6,7,8,8a-octahydro-1H-phthalazine-6-sulfonamide.
| Compound Name | 1-[2-methoxy-4-(trifluoromethyl)phenyl]-4-oxo-N-pyrimidin-4-yl-2,3,4a,5,6,7,8,8a-octahydro-1H-phthalazine-6-sulfonamide |
|---|---|
| PubChem CID | 91970608 |
| Molecular Formula | C20H22F3N5O4S |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 1-[2-methoxy-4-(trifluoromethyl)phenyl]-4-oxo-N-pyrimidin-4-yl-2,3,4a,5,6,7,8,8a-octahydro-1H-phthalazine-6-sulfonamide |
| SMILES | COc1cc(C(F)(F)F)ccc1C1NNC(=O)C2CC(S(=O)(=O)Nc3ccncn3)CCC21 |
| InChI | InChI=1S/C20H22F3N5O4S/c1-32-16-8-11(20(21,22)23)2-4-14(16)18-13-5-3-12(9-15(13)19(29)27-26-18)33(30,31)28-17-6-7-24-10-25-17/h2,4,6-8,10,12-13,15,18,26H,3,5,9H2,1H3,(H,27,29)(H,24,25,28) |
| InChIKey | AGWLNVHYUNHJKR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |