About N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine
N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine (PubChem CID 91970638) has the molecular formula C14H23BrN2
and a molecular weight of 299.26 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine |
| PubChem CID | 91970638 |
| Molecular Formula | C14H23BrN2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine |
| SMILES | CC(C)(C)NCCCNCc1cccc(Br)c1 |
| InChI | InChI=1S/C14H23BrN2/c1-14(2,3)17-9-5-8-16-11-12-6-4-7-13(15)10-12/h4,6-7,10,16-17H,5,8-9,11H2,1-3H3 |
| InChIKey | AHAZFMYWCXMHOO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine?
The IUPAC name of N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine (CID 91970638) is N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine.
What is the SMILES notation for N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine?
The canonical SMILES for N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine is CC(C)(C)NCCCNCc1cccc(Br)c1.
What is the InChIKey of N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine?
The InChIKey is AHAZFMYWCXMHOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23BrN2/c1-14(2,3)17-9-5-8-16-11-12-6-4-7-13(15)10-12/h4,6-7,10,16-17H,5,8-9,11H2,1-3H3.
What are the key properties of N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine?
N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine has a molecular weight of 299.26 g/mol, XLogP of 3.32, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-bromophenyl)methyl]-N'-tert-butylpropane-1,3-diamine is sourced from PubChem (CID 91970638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).