C30H38FN5O2S — CID 91970809
N-[(3R,5S)-1-[(2-fluoro-6-methoxyphenyl)methyl]-5-methylpiperidin-3-yl]-3-(2-methyl-1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 91970809) has the molecular formula C30H38FN5O2S and a molecular weight of 551.73 g/mol. Its IUPAC name is N-[(3R,5S)-1-[(2-fluoro-6-methoxyphenyl)methyl]-5-methylpiperidin-3-yl]-3-(2-methyl-1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[(3R,5S)-1-[(2-fluoro-6-methoxyphenyl)methyl]-5-methylpiperidin-3-yl]-3-(2-methyl-1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 91970809 |
| Molecular Formula | C30H38FN5O2S |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | N-[(3R,5S)-1-[(2-fluoro-6-methoxyphenyl)methyl]-5-methylpiperidin-3-yl]-3-(2-methyl-1,3-benzothiazol-6-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | COc1cccc(F)c1CN1C[C@@H](C)C[C@@H](NC(=O)C2CCC3NNC(c4ccc5nc(C)sc5c4)C3C2)C1 |
| InChI | InChI=1S/C30H38FN5O2S/c1-17-11-21(15-36(14-17)16-23-24(31)5-4-6-27(23)38-3)33-30(37)20-8-9-25-22(12-20)29(35-34-25)19-7-10-26-28(13-19)39-18(2)32-26/h4-7,10,13,17,20-22,25,29,34-35H,8-9,11-12,14-16H2,1-3H3,(H,33,37)/t17-,20?,21+,22?,25?,29?/m0/s1 |
| InChIKey | DVBSHBGSWCHPIC-CVCXEWSMSA-N |
| XLogP | 4.71 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |