C31H37F4N5O2 — CID 91970824
N-[(1R,5S)-3-[(2-fluoro-6-methoxyphenyl)methyl]-5-(trifluoromethyl)cyclohexyl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 91970824) has the molecular formula C31H37F4N5O2 and a molecular weight of 587.66 g/mol. Its IUPAC name is N-[(1R,5S)-3-[(2-fluoro-6-methoxyphenyl)methyl]-5-(trifluoromethyl)cyclohexyl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[(1R,5S)-3-[(2-fluoro-6-methoxyphenyl)methyl]-5-(trifluoromethyl)cyclohexyl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 91970824 |
| Molecular Formula | C31H37F4N5O2 |
| Molecular Weight | 587.66 g/mol |
| Exact Mass | 587.29 |
| IUPAC Name | N-[(1R,5S)-3-[(2-fluoro-6-methoxyphenyl)methyl]-5-(trifluoromethyl)cyclohexyl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | COc1cccc(F)c1CC1C[C@@H](NC(=O)C2CCC3NNC(c4ccc5nn(C)cc5c4)C3C2)C[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C31H37F4N5O2/c1-40-16-20-13-18(6-8-26(20)39-40)29-24-14-19(7-9-27(24)37-38-29)30(41)36-22-11-17(10-21(15-22)31(33,34)35)12-23-25(32)4-3-5-28(23)42-2/h3-6,8,13,16-17,19,21-22,24,27,29,37-38H,7,9-12,14-15H2,1-2H3,(H,36,41)/t17?,19?,21-,22+,24?,27?,29?/m0/s1 |
| InChIKey | HHVSPHVORYQFRO-LLQQVZRUSA-N |
| XLogP | 5.36 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.66 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |