C32H42FN7O3 — CID 91970861
N-[(3R,6S)-6-(dimethylcarbamoyl)-1-[(2-fluoro-6-methoxyphenyl)methyl]piperidin-3-yl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide (PubChem CID 91970861) has the molecular formula C32H42FN7O3 and a molecular weight of 591.73 g/mol. Its IUPAC name is N-[(3R,6S)-6-(dimethylcarbamoyl)-1-[(2-fluoro-6-methoxyphenyl)methyl]piperidin-3-yl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide.
| Compound Name | N-[(3R,6S)-6-(dimethylcarbamoyl)-1-[(2-fluoro-6-methoxyphenyl)methyl]piperidin-3-yl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
|---|---|
| PubChem CID | 91970861 |
| Molecular Formula | C32H42FN7O3 |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.33 |
| IUPAC Name | N-[(3R,6S)-6-(dimethylcarbamoyl)-1-[(2-fluoro-6-methoxyphenyl)methyl]piperidin-3-yl]-3-(2-methylindazol-5-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-5-carboxamide |
| SMILES | COc1cccc(F)c1CN1C[C@H](NC(=O)C2CCC3NNC(c4ccc5nn(C)cc5c4)C3C2)CC[C@H]1C(=O)N(C)C |
| InChI | InChI=1S/C32H42FN7O3/c1-38(2)32(42)28-13-10-22(17-40(28)18-24-25(33)6-5-7-29(24)43-4)34-31(41)20-9-12-27-23(15-20)30(36-35-27)19-8-11-26-21(14-19)16-39(3)37-26/h5-8,11,14,16,20,22-23,27-28,30,35-36H,9-10,12-13,15,17-18H2,1-4H3,(H,34,41)/t20?,22-,23?,27?,28+,30?/m1/s1 |
| InChIKey | ZKSQYPMAUSMHDF-ZNJLFUFVSA-N |
| XLogP | 2.89 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |