About Alrizomadlin
Alrizomadlin (PubChem CID 91972012) has the molecular formula C34H38Cl2FN3O4
and a molecular weight of 642.60 g/mol.
Molecular Properties
| Compound Name | Alrizomadlin |
| PubChem CID | 91972012 |
| Molecular Formula | C34H38Cl2FN3O4 |
| Molecular Weight | 642.60 g/mol |
| Exact Mass | 641.22 |
| IUPAC Name | — |
| SMILES | CCN1[C@@H](C(=O)NC23CCC(C(=O)O)(CC2)CC3)[C@H](c2cccc(Cl)c2F)[C@]2(C(=O)Nc3cc(Cl)ccc32)C12CCCCC2 |
| InChI | InChI=1S/C34H38Cl2FN3O4/c1-2-40-27(28(41)39-32-16-13-31(14-17-32,15-18-32)30(43)44)25(21-7-6-8-23(36)26(21)37)34(33(40)11-4-3-5-12-33)22-10-9-20(35)19-24(22)38-29(34)42/h6-10,19,25,27H,2-5,11-18H2,1H3,(H,38,42)(H,39,41)(H,43,44)/t25-,27+,31?,32?,34+/m0/s1 |
| InChIKey | YJCZPJQGFSSFOL-MNZPCBJKSA-N |
| XLogP | 6.81 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 642.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Alrizomadlin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Alrizomadlin?
The IUPAC name of Alrizomadlin (CID 91972012) is not available.
What is the SMILES notation for Alrizomadlin?
The canonical SMILES for Alrizomadlin is CCN1[C@@H](C(=O)NC23CCC(C(=O)O)(CC2)CC3)[C@H](c2cccc(Cl)c2F)[C@]2(C(=O)Nc3cc(Cl)ccc32)C12CCCCC2.
What is the InChIKey of Alrizomadlin?
The InChIKey is YJCZPJQGFSSFOL-MNZPCBJKSA-N. The full InChI is InChI=1S/C34H38Cl2FN3O4/c1-2-40-27(28(41)39-32-16-13-31(14-17-32,15-18-32)30(43)44)25(21-7-6-8-23(36)26(21)37)34(33(40)11-4-3-5-12-33)22-10-9-20(35)19-24(22)38-29(34)42/h6-10,19,25,27H,2-5,11-18H2,1H3,(H,38,42)(H,39,41)(H,43,44)/t25-,27+,31?,32?,34+/m0/s1.
What are the key properties of Alrizomadlin?
Alrizomadlin has a molecular weight of 642.60 g/mol, XLogP of 6.81, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Alrizomadlin is sourced from PubChem (CID 91972012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).