About (4E,6E)-3-hydroxydeca-4,6-dienoate
(4E,6E)-3-hydroxydeca-4,6-dienoate (PubChem CID 91972206) has the molecular formula C10H15O3-
and a molecular weight of 183.23 g/mol. Its IUPAC name is (4E,6E)-3-hydroxydeca-4,6-dienoate.
Molecular Properties
| Compound Name | (4E,6E)-3-hydroxydeca-4,6-dienoate |
| PubChem CID | 91972206 |
| Molecular Formula | C10H15O3- |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | (4E,6E)-3-hydroxydeca-4,6-dienoate |
| SMILES | CCC/C=C/C=C/C(O)CC(=O)[O-] |
| InChI | InChI=1S/C10H16O3/c1-2-3-4-5-6-7-9(11)8-10(12)13/h4-7,9,11H,2-3,8H2,1H3,(H,12,13)/p-1/b5-4+,7-6+ |
| InChIKey | PHDSHECSYICDQB-YTXTXJHMSA-M |
| XLogP | 0.40 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E,6E)-3-hydroxydeca-4,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,6E)-3-hydroxydeca-4,6-dienoate?
The IUPAC name of (4E,6E)-3-hydroxydeca-4,6-dienoate (CID 91972206) is (4E,6E)-3-hydroxydeca-4,6-dienoate.
What is the SMILES notation for (4E,6E)-3-hydroxydeca-4,6-dienoate?
The canonical SMILES for (4E,6E)-3-hydroxydeca-4,6-dienoate is CCC/C=C/C=C/C(O)CC(=O)[O-].
What is the InChIKey of (4E,6E)-3-hydroxydeca-4,6-dienoate?
The InChIKey is PHDSHECSYICDQB-YTXTXJHMSA-M. The full InChI is InChI=1S/C10H16O3/c1-2-3-4-5-6-7-9(11)8-10(12)13/h4-7,9,11H,2-3,8H2,1H3,(H,12,13)/p-1/b5-4+,7-6+.
What are the key properties of (4E,6E)-3-hydroxydeca-4,6-dienoate?
(4E,6E)-3-hydroxydeca-4,6-dienoate has a molecular weight of 183.23 g/mol, XLogP of 0.40, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,6E)-3-hydroxydeca-4,6-dienoate is sourced from PubChem (CID 91972206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).