About 2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile
2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile (PubChem CID 91972340) has the molecular formula C19H18N2O4
and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile.
Molecular Properties
| Compound Name | 2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile |
| PubChem CID | 91972340 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile |
| SMILES | COc1ccc2c(c1)OC(N)=C(C#N)C2c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C19H18N2O4/c1-22-12-5-6-13-16(9-12)25-19(21)14(10-20)18(13)11-4-7-15(23-2)17(8-11)24-3/h4-9,18H,21H2,1-3H3 |
| InChIKey | INEIIWNLGICCQL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 86.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile?
The IUPAC name of 2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile (CID 91972340) is 2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile.
What is the SMILES notation for 2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile?
The canonical SMILES for 2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile is COc1ccc2c(c1)OC(N)=C(C#N)C2c1ccc(OC)c(OC)c1.
What is the InChIKey of 2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile?
The InChIKey is INEIIWNLGICCQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O4/c1-22-12-5-6-13-16(9-12)25-19(21)14(10-20)18(13)11-4-7-15(23-2)17(8-11)24-3/h4-9,18H,21H2,1-3H3.
What are the key properties of 2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile?
2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile has a molecular weight of 338.36 g/mol, XLogP of 2.93, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromene-3-carbonitrile is sourced from PubChem (CID 91972340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).