C20H14O7 — CID 91972961
methyl 3-(1,3-benzodioxol-5-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate (PubChem CID 91972961) has the molecular formula C20H14O7 and a molecular weight of 366.33 g/mol. Its IUPAC name is methyl 3-(1,3-benzodioxol-5-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate.
| Compound Name | methyl 3-(1,3-benzodioxol-5-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 91972961 |
| Molecular Formula | C20H14O7 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | methyl 3-(1,3-benzodioxol-5-yl)-4-oxo-2,3-dihydrofuro[3,2-c]chromene-2-carboxylate |
| SMILES | COC(=O)C1Oc2c(c(=O)oc3ccccc23)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H14O7/c1-23-20(22)18-15(10-6-7-13-14(8-10)25-9-24-13)16-17(27-18)11-4-2-3-5-12(11)26-19(16)21/h2-8,15,18H,9H2,1H3 |
| InChIKey | BUYSYRZBJJUZQY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|