C27H24N2O8 — CID 91973124
(4E)-5-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 91973124) has the molecular formula C27H24N2O8 and a molecular weight of 504.50 g/mol. Its IUPAC name is (4E)-5-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91973124 |
| Molecular Formula | C27H24N2O8 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | (4E)-5-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-4-[hydroxy-(3-methoxyphenyl)methylidene]-1-(pyridin-4-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1cccc(/C(O)=C2\C(=O)C(=O)N(Cc3ccncc3)C2c2cc(OC)c3c(c2OC)OCO3)c1 |
| InChI | InChI=1S/C27H24N2O8/c1-33-17-6-4-5-16(11-17)22(30)20-21(29(27(32)23(20)31)13-15-7-9-28-10-8-15)18-12-19(34-2)25-26(24(18)35-3)37-14-36-25/h4-12,21,30H,13-14H2,1-3H3/b22-20+ |
| InChIKey | DIZRJDMQQJYWMT-LSDHQDQOSA-N |
| XLogP | 3.46 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|