About 4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole
4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole (PubChem CID 91973278) has the molecular formula C19H20N2O4
and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole |
| PubChem CID | 91973278 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole |
| SMILES | COc1ccc(-c2cn[nH]c2-c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H20N2O4/c1-22-14-7-5-12(6-8-14)15-11-20-21-18(15)13-9-16(23-2)19(25-4)17(10-13)24-3/h5-11H,1-4H3,(H,20,21) |
| InChIKey | VYYMOJHULCKDCT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole?
The IUPAC name of 4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole (CID 91973278) is 4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole.
What is the SMILES notation for 4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole?
The canonical SMILES for 4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole is COc1ccc(-c2cn[nH]c2-c2cc(OC)c(OC)c(OC)c2)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole?
The InChIKey is VYYMOJHULCKDCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O4/c1-22-14-7-5-12(6-8-14)15-11-20-21-18(15)13-9-16(23-2)19(25-4)17(10-13)24-3/h5-11H,1-4H3,(H,20,21).
What are the key properties of 4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole?
4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole has a molecular weight of 340.38 g/mol, XLogP of 3.78, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)-1H-pyrazole is sourced from PubChem (CID 91973278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).