C17H17N5 — CID 91973291
4-amino-2-(diethylamino)-6-phenylpyridine-3,5-dicarbonitrile (PubChem CID 91973291) has the molecular formula C17H17N5 and a molecular weight of 291.36 g/mol. Its IUPAC name is 4-amino-2-(diethylamino)-6-phenylpyridine-3,5-dicarbonitrile.
| Compound Name | 4-amino-2-(diethylamino)-6-phenylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 91973291 |
| Molecular Formula | C17H17N5 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 4-amino-2-(diethylamino)-6-phenylpyridine-3,5-dicarbonitrile |
| SMILES | CCN(CC)c1nc(-c2ccccc2)c(C#N)c(N)c1C#N |
| InChI | InChI=1S/C17H17N5/c1-3-22(4-2)17-14(11-19)15(20)13(10-18)16(21-17)12-8-6-5-7-9-12/h5-9H,3-4H2,1-2H3,(H2,20,21) |
| InChIKey | NPZNVNKOWZGZRD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |