C24H26N4OS — CID 91973328
(E)-N-cyclohexyl-2-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-phenylprop-2-enamide (PubChem CID 91973328) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is (E)-N-cyclohexyl-2-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-cyclohexyl-2-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 91973328 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | (E)-N-cyclohexyl-2-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-phenylprop-2-enamide |
| SMILES | Cc1ccc(-c2nc(S/C(=C/c3ccccc3)C(=O)NC3CCCCC3)n[nH]2)cc1 |
| InChI | InChI=1S/C24H26N4OS/c1-17-12-14-19(15-13-17)22-26-24(28-27-22)30-21(16-18-8-4-2-5-9-18)23(29)25-20-10-6-3-7-11-20/h2,4-5,8-9,12-16,20H,3,6-7,10-11H2,1H3,(H,25,29)(H,26,27,28)/b21-16+ |
| InChIKey | KVOBXXDAHXHACQ-LTGZKZEYSA-N |
| XLogP | 5.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|