C18H15NO5 — CID 91973332
4-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-5-phenyl-1,2-oxazole (PubChem CID 91973332) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-5-phenyl-1,2-oxazole.
| Compound Name | 4-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-5-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 91973332 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-(4,7-dimethoxy-1,3-benzodioxol-5-yl)-5-phenyl-1,2-oxazole |
| SMILES | COc1cc(-c2cnoc2-c2ccccc2)c(OC)c2c1OCO2 |
| InChI | InChI=1S/C18H15NO5/c1-20-14-8-12(16(21-2)18-17(14)22-10-23-18)13-9-19-24-15(13)11-6-4-3-5-7-11/h3-9H,10H2,1-2H3 |
| InChIKey | HELABZGSOKLRNB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 62.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |