C20H19BrO7 — CID 91973475
(E)-1-(2-bromo-4,5-dimethoxyphenyl)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one (PubChem CID 91973475) has the molecular formula C20H19BrO7 and a molecular weight of 451.27 g/mol. Its IUPAC name is (E)-1-(2-bromo-4,5-dimethoxyphenyl)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(2-bromo-4,5-dimethoxyphenyl)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 91973475 |
| Molecular Formula | C20H19BrO7 |
| Molecular Weight | 451.27 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | (E)-1-(2-bromo-4,5-dimethoxyphenyl)-3-(6,7-dimethoxy-1,3-benzodioxol-5-yl)prop-2-en-1-one |
| SMILES | COc1cc(Br)c(C(=O)/C=C/c2cc3c(c(OC)c2OC)OCO3)cc1OC |
| InChI | InChI=1S/C20H19BrO7/c1-23-15-8-12(13(21)9-16(15)24-2)14(22)6-5-11-7-17-19(28-10-27-17)20(26-4)18(11)25-3/h5-9H,10H2,1-4H3/b6-5+ |
| InChIKey | FGSXONGUPRNJCY-AATRIKPKSA-N |
| XLogP | 4.11 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|