C19H29N3S — CID 91973776
(4-methylpiperazin-1-yl)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanethione (PubChem CID 91973776) has the molecular formula C19H29N3S and a molecular weight of 331.53 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanethione.
| Compound Name | (4-methylpiperazin-1-yl)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanethione |
|---|---|
| PubChem CID | 91973776 |
| Molecular Formula | C19H29N3S |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (4-methylpiperazin-1-yl)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanethione |
| SMILES | CC1CC(C)(C)N(C)c2ccc(C(=S)N3CCN(C)CC3)cc21 |
| InChI | InChI=1S/C19H29N3S/c1-14-13-19(2,3)21(5)17-7-6-15(12-16(14)17)18(23)22-10-8-20(4)9-11-22/h6-7,12,14H,8-11,13H2,1-5H3 |
| InChIKey | ALVKBFQJSMMOTI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|