C22H34N6O9 — CID 91974457
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid (PubChem CID 91974457) has the molecular formula C22H34N6O9 and a molecular weight of 526.55 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 91974457 |
| Molecular Formula | C22H34N6O9 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-4-carboxybutanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@@H](N)Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C22H34N6O9/c1-11(2)7-16(22(36)37)28-21(35)15(4-6-18(31)32)27-20(34)14(3-5-17(29)30)26-19(33)13(23)8-12-9-24-10-25-12/h9-11,13-16H,3-8,23H2,1-2H3,(H,24,25)(H,26,33)(H,27,34)(H,28,35)(H,29,30)(H,31,32)(H,36,37)/t13-,14-,15-,16-/m0/s1 |
| InChIKey | ACFGOMCCGMXPGW-VGWMRTNUSA-N |
| XLogP | -1.41 |
| TPSA | 253.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |