C17H14F3N3O2S — CID 9197708
2-[methyl-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 9197708) has the molecular formula C17H14F3N3O2S and a molecular weight of 381.38 g/mol. Its IUPAC name is 2-[methyl-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[methyl-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 9197708 |
| Molecular Formula | C17H14F3N3O2S |
| Molecular Weight | 381.38 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2-[methyl-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)Cc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C17H14F3N3O2S/c1-23(7-10-9-25-17(21-10)13-3-2-6-26-13)8-14(24)22-12-5-4-11(18)15(19)16(12)20/h2-6,9H,7-8H2,1H3,(H,22,24) |
| InChIKey | ZUNKLUVVQARNJV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|