C31H47ClN8O10 — CID 91977086
5-chloro-15,28-dihydroxy-23-(hydroxymethyl)-23-methyl-10-(6-methylhepta-2,4-dienyl)-21-oxa-1,7,8,11,17,18,24,30-octazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone (PubChem CID 91977086) has the molecular formula C31H47ClN8O10 and a molecular weight of 727.22 g/mol. Its IUPAC name is 5-chloro-15,28-dihydroxy-23-(hydroxymethyl)-23-methyl-10-(6-methylhepta-2,4-dienyl)-21-oxa-1,7,8,11,17,18,24,30-octazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone.
| Compound Name | 5-chloro-15,28-dihydroxy-23-(hydroxymethyl)-23-methyl-10-(6-methylhepta-2,4-dienyl)-21-oxa-1,7,8,11,17,18,24,30-octazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone |
|---|---|
| PubChem CID | 91977086 |
| Molecular Formula | C31H47ClN8O10 |
| Molecular Weight | 727.22 g/mol |
| Exact Mass | 726.31 |
| IUPAC Name | 5-chloro-15,28-dihydroxy-23-(hydroxymethyl)-23-methyl-10-(6-methylhepta-2,4-dienyl)-21-oxa-1,7,8,11,17,18,24,30-octazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone |
| SMILES | CC(C)C=CC=CCC1NC(=O)C2CC(O)CNN2C(=O)COC(=O)C(C)(CO)NC(=O)C2CC(O)CNN2C(=O)C2CC(Cl)CNN2C1=O |
| InChI | InChI=1S/C31H47ClN8O10/c1-17(2)7-5-4-6-8-21-28(47)40-24(9-18(32)12-33-40)29(48)39-23(11-20(43)14-35-39)27(46)37-31(3,16-41)30(49)50-15-25(44)38-22(26(45)36-21)10-19(42)13-34-38/h4-7,17-24,33-35,41-43H,8-16H2,1-3H3,(H,36,45)(H,37,46) |
| InChIKey | OHBCWVJHZZYAHJ-UHFFFAOYSA-N |
| XLogP | -3.30 |
| TPSA | 242.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.22 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|