C30H37N3O4 — CID 91977788
ethyl (2S)-3-(1H-indol-3-yl)-2-[[(2S)-1-(6-phenylhexanoyl)pyrrolidine-2-carbonyl]amino]propanoate (PubChem CID 91977788) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is ethyl (2S)-3-(1H-indol-3-yl)-2-[[(2S)-1-(6-phenylhexanoyl)pyrrolidine-2-carbonyl]amino]propanoate.
| Compound Name | ethyl (2S)-3-(1H-indol-3-yl)-2-[[(2S)-1-(6-phenylhexanoyl)pyrrolidine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 91977788 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | ethyl (2S)-3-(1H-indol-3-yl)-2-[[(2S)-1-(6-phenylhexanoyl)pyrrolidine-2-carbonyl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H]1CCCN1C(=O)CCCCCc1ccccc1 |
| InChI | InChI=1S/C30H37N3O4/c1-2-37-30(36)26(20-23-21-31-25-16-10-9-15-24(23)25)32-29(35)27-17-11-19-33(27)28(34)18-8-4-7-14-22-12-5-3-6-13-22/h3,5-6,9-10,12-13,15-16,21,26-27,31H,2,4,7-8,11,14,17-20H2,1H3,(H,32,35)/t26-,27-/m0/s1 |
| InChIKey | SOEJFKHAZVAOBU-SVBPBHIXSA-N |
| XLogP | 4.55 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|