2-(1,3-oxazolidin-4-yl)acetic acid

C5H9NO3 — CID 91979915

IUPAC2-(1,3-oxazolidin-4-yl)acetic acid
SMILESO=C(O)CC1COCN1
InChIInChI=1S/C5H9NO3/c7-5(8)1-4-2-9-3-6-4/h4,6H,1-3H2,(H,7,8)
InChIKeyQPRQYXOPAOTGPX-UHFFFAOYSA-N
MW131.13 g/mol
LogP-0.59
Rot. Bonds2

About 2-(1,3-oxazolidin-4-yl)acetic acid

2-(1,3-oxazolidin-4-yl)acetic acid (PubChem CID 91979915) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is 2-(1,3-oxazolidin-4-yl)acetic acid.

Molecular Properties

Compound Name2-(1,3-oxazolidin-4-yl)acetic acid
PubChem CID91979915
Molecular FormulaC5H9NO3
Molecular Weight131.13 g/mol
Exact Mass131.06
IUPAC Name2-(1,3-oxazolidin-4-yl)acetic acid
SMILESO=C(O)CC1COCN1
InChIInChI=1S/C5H9NO3/c7-5(8)1-4-2-9-3-6-4/h4,6H,1-3H2,(H,7,8)
InChIKeyQPRQYXOPAOTGPX-UHFFFAOYSA-N
XLogP-0.59
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500131.13
LogP ≤ 5-0.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(1,3-oxazolidin-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-oxazolidin-4-yl)acetic acid?
The IUPAC name of 2-(1,3-oxazolidin-4-yl)acetic acid (CID 91979915) is 2-(1,3-oxazolidin-4-yl)acetic acid.
What is the SMILES notation for 2-(1,3-oxazolidin-4-yl)acetic acid?
The canonical SMILES for 2-(1,3-oxazolidin-4-yl)acetic acid is O=C(O)CC1COCN1.
What is the InChIKey of 2-(1,3-oxazolidin-4-yl)acetic acid?
The InChIKey is QPRQYXOPAOTGPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO3/c7-5(8)1-4-2-9-3-6-4/h4,6H,1-3H2,(H,7,8).
What are the key properties of 2-(1,3-oxazolidin-4-yl)acetic acid?
2-(1,3-oxazolidin-4-yl)acetic acid has a molecular weight of 131.13 g/mol, XLogP of -0.59, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-oxazolidin-4-yl)acetic acid is sourced from PubChem (CID 91979915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).