About 1,1-dioxothiolan-3-amine;hydron;chloride
1,1-dioxothiolan-3-amine;hydron;chloride (PubChem CID 91979966) has the molecular formula C4H10ClNO2S
and a molecular weight of 171.65 g/mol. Its IUPAC name is 1,1-dioxothiolan-3-amine;hydron;chloride.
Molecular Properties
| Compound Name | 1,1-dioxothiolan-3-amine;hydron;chloride |
| PubChem CID | 91979966 |
| Molecular Formula | C4H10ClNO2S |
| Molecular Weight | 171.65 g/mol |
| Exact Mass | 171.01 |
| IUPAC Name | 1,1-dioxothiolan-3-amine;hydron;chloride |
| SMILES | NC1CCS(=O)(=O)C1.[Cl-].[H+] |
| InChI | InChI=1S/C4H9NO2S.ClH/c5-4-1-2-8(6,7)3-4;/h4H,1-3,5H2;1H |
| InChIKey | MGZQMSFXPSKBDY-UHFFFAOYSA-N |
| XLogP | -3.75 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.65 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-dioxothiolan-3-amine;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxothiolan-3-amine;hydron;chloride?
The IUPAC name of 1,1-dioxothiolan-3-amine;hydron;chloride (CID 91979966) is 1,1-dioxothiolan-3-amine;hydron;chloride.
What is the SMILES notation for 1,1-dioxothiolan-3-amine;hydron;chloride?
The canonical SMILES for 1,1-dioxothiolan-3-amine;hydron;chloride is NC1CCS(=O)(=O)C1.[Cl-].[H+].
What is the InChIKey of 1,1-dioxothiolan-3-amine;hydron;chloride?
The InChIKey is MGZQMSFXPSKBDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2S.ClH/c5-4-1-2-8(6,7)3-4;/h4H,1-3,5H2;1H.
What are the key properties of 1,1-dioxothiolan-3-amine;hydron;chloride?
1,1-dioxothiolan-3-amine;hydron;chloride has a molecular weight of 171.65 g/mol, XLogP of -3.75, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxothiolan-3-amine;hydron;chloride is sourced from PubChem (CID 91979966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).