C12H22O — CID 91980008
(2R,5S)-5-tert-butyl-2-methyl-5-propyl-2H-furan (PubChem CID 91980008) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is (2R,5S)-5-tert-butyl-2-methyl-5-propyl-2H-furan.
| Compound Name | (2R,5S)-5-tert-butyl-2-methyl-5-propyl-2H-furan |
|---|---|
| PubChem CID | 91980008 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | (2R,5S)-5-tert-butyl-2-methyl-5-propyl-2H-furan |
| SMILES | CCC[C@@]1(C(C)(C)C)C=C[C@@H](C)O1 |
| InChI | InChI=1S/C12H22O/c1-6-8-12(11(3,4)5)9-7-10(2)13-12/h7,9-10H,6,8H2,1-5H3/t10-,12+/m1/s1 |
| InChIKey | BWJMAXUUBRFWGV-PWSUYJOCSA-N |
| XLogP | 3.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|