About sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione
sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione (PubChem CID 91980486) has the molecular formula C12H17N2NaO2S
and a molecular weight of 276.34 g/mol. Its IUPAC name is sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione.
Molecular Properties
| Compound Name | sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione |
| PubChem CID | 91980486 |
| Molecular Formula | C12H17N2NaO2S |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione |
| SMILES | C=CCC1(C(C)CCC)C(=O)[N-]C(=S)NC1=O.[Na+] |
| InChI | InChI=1S/C12H18N2O2S.Na/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16;/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17);/q;+1/p-1 |
| InChIKey | LYZGJWXNOGIVQA-UHFFFAOYSA-M |
| XLogP | -0.70 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione?
The IUPAC name of sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione (CID 91980486) is sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione.
What is the SMILES notation for sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione?
The canonical SMILES for sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione is C=CCC1(C(C)CCC)C(=O)[N-]C(=S)NC1=O.[Na+].
What is the InChIKey of sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione?
The InChIKey is LYZGJWXNOGIVQA-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H18N2O2S.Na/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16;/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17);/q;+1/p-1.
What are the key properties of sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione?
sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione has a molecular weight of 276.34 g/mol, XLogP of -0.70, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-pentan-2-yl-5-prop-2-enyl-2-sulfanylidenepyrimidin-3-ide-4,6-dione is sourced from PubChem (CID 91980486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).