C12H22N4 — CID 91982537
1,2-bis(3,4,5,6-tetrahydro-2H-azepin-7-yl)hydrazine (PubChem CID 91982537) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 1,2-bis(3,4,5,6-tetrahydro-2H-azepin-7-yl)hydrazine.
| Compound Name | 1,2-bis(3,4,5,6-tetrahydro-2H-azepin-7-yl)hydrazine |
|---|---|
| PubChem CID | 91982537 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 1,2-bis(3,4,5,6-tetrahydro-2H-azepin-7-yl)hydrazine |
| SMILES | C1CCN=C(NNC2=NCCCCC2)CC1 |
| InChI | InChI=1S/C12H22N4/c1-3-7-11(13-9-5-1)15-16-12-8-4-2-6-10-14-12/h1-10H2,(H,13,15)(H,14,16) |
| InChIKey | PWFPAGJVIJEFPS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|