2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid

C10H9N3O4 — CID 919828

IUPAC2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid
SMILESNc1noc(-c2ccccc2OCC(=O)O)n1
InChIInChI=1S/C10H9N3O4/c11-10-12-9(17-13-10)6-3-1-2-4-7(6)16-5-8(14)15/h1-4H,5H2,(H2,11,13)(H,14,15)
InChIKeyIBNHSPRIVXLFBA-UHFFFAOYSA-N
MW235.20 g/mol
LogP0.78
Rot. Bonds4

About 2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid

2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid (PubChem CID 919828) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid.

Molecular Properties

Compound Name2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid
PubChem CID919828
Molecular FormulaC10H9N3O4
Molecular Weight235.20 g/mol
Exact Mass235.06
IUPAC Name2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid
SMILESNc1noc(-c2ccccc2OCC(=O)O)n1
InChIInChI=1S/C10H9N3O4/c11-10-12-9(17-13-10)6-3-1-2-4-7(6)16-5-8(14)15/h1-4H,5H2,(H2,11,13)(H,14,15)
InChIKeyIBNHSPRIVXLFBA-UHFFFAOYSA-N
XLogP0.78
TPSA111.47 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.20
LogP ≤ 50.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid?
The IUPAC name of 2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid (CID 919828) is 2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid.
What is the SMILES notation for 2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid?
The canonical SMILES for 2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid is Nc1noc(-c2ccccc2OCC(=O)O)n1.
What is the InChIKey of 2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid?
The InChIKey is IBNHSPRIVXLFBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O4/c11-10-12-9(17-13-10)6-3-1-2-4-7(6)16-5-8(14)15/h1-4H,5H2,(H2,11,13)(H,14,15).
What are the key properties of 2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid?
2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid has a molecular weight of 235.20 g/mol, XLogP of 0.78, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid is sourced from PubChem (CID 919828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).