C10H9N3O4 — CID 919828
2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid (PubChem CID 919828) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid.
| Compound Name | 2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 919828 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-[2-(3-amino-1,2,4-oxadiazol-5-yl)phenoxy]acetic acid |
| SMILES | Nc1noc(-c2ccccc2OCC(=O)O)n1 |
| InChI | InChI=1S/C10H9N3O4/c11-10-12-9(17-13-10)6-3-1-2-4-7(6)16-5-8(14)15/h1-4H,5H2,(H2,11,13)(H,14,15) |
| InChIKey | IBNHSPRIVXLFBA-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |