C9H14Br2N2 — CID 91982951
1,2,3,4-tetrahydroisoquinolin-6-amine;dihydrobromide (PubChem CID 91982951) has the molecular formula C9H14Br2N2 and a molecular weight of 310.03 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroisoquinolin-6-amine;dihydrobromide.
| Compound Name | 1,2,3,4-tetrahydroisoquinolin-6-amine;dihydrobromide |
|---|---|
| PubChem CID | 91982951 |
| Molecular Formula | C9H14Br2N2 |
| Molecular Weight | 310.03 g/mol |
| Exact Mass | 307.95 |
| IUPAC Name | 1,2,3,4-tetrahydroisoquinolin-6-amine;dihydrobromide |
| SMILES | Br.Br.Nc1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C9H12N2.2BrH/c10-9-2-1-8-6-11-4-3-7(8)5-9;;/h1-2,5,11H,3-4,6,10H2;2*1H |
| InChIKey | CXYNTJAQKCIKCN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.03 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|