C17H14N2O5 — CID 919830
2-[3-hydroxy-4-(4-phenoxy-1H-pyrazol-5-yl)phenoxy]acetic acid (PubChem CID 919830) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-[3-hydroxy-4-(4-phenoxy-1H-pyrazol-5-yl)phenoxy]acetic acid.
| Compound Name | 2-[3-hydroxy-4-(4-phenoxy-1H-pyrazol-5-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 919830 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[3-hydroxy-4-(4-phenoxy-1H-pyrazol-5-yl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(-c2[nH]ncc2Oc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C17H14N2O5/c20-14-8-12(23-10-16(21)22)6-7-13(14)17-15(9-18-19-17)24-11-4-2-1-3-5-11/h1-9,20H,10H2,(H,18,19)(H,21,22) |
| InChIKey | LRRAGYAQNDCAIR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 104.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |