C15H22N4O4 — CID 9198346
(2R)-2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-N-(methylcarbamoyl)propanamide (PubChem CID 9198346) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is (2R)-2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-N-(methylcarbamoyl)propanamide.
| Compound Name | (2R)-2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 9198346 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (2R)-2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)[C@@H](C)N(C)CC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C15H22N4O4/c1-10(14(21)18-15(22)16-2)19(3)9-13(20)17-11-6-5-7-12(8-11)23-4/h5-8,10H,9H2,1-4H3,(H,17,20)(H2,16,18,21,22)/t10-/m1/s1 |
| InChIKey | XZLTUBNMBDKFMB-SNVBAGLBSA-N |
| XLogP | 0.41 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |