About CID 91983969
CID 91983969 (PubChem CID 91983969) has the molecular formula C6H8BLiNO2
and a molecular weight of 143.89 g/mol.
Molecular Properties
| Compound Name | CID 91983969 |
| PubChem CID | 91983969 |
| Molecular Formula | C6H8BLiNO2 |
| Molecular Weight | 143.89 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | — |
| SMILES | Cc1cccnc1B(O)O.[Li] |
| InChI | InChI=1S/C6H8BNO2.Li/c1-5-3-2-4-8-6(5)7(9)10;/h2-4,9-10H,1H3; |
| InChIKey | DSACULURACWXJF-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.89 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 91983969 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91983969?
The IUPAC name of CID 91983969 (CID 91983969) is not available.
What is the SMILES notation for CID 91983969?
The canonical SMILES for CID 91983969 is Cc1cccnc1B(O)O.[Li].
What is the InChIKey of CID 91983969?
The InChIKey is DSACULURACWXJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8BNO2.Li/c1-5-3-2-4-8-6(5)7(9)10;/h2-4,9-10H,1H3;.
What are the key properties of CID 91983969?
CID 91983969 has a molecular weight of 143.89 g/mol, XLogP of -1.31, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91983969 is sourced from PubChem (CID 91983969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).