C11H19NO6 — CID 91987645
tert-butyl N-[(1R,2R,3R,4R,5R)-2,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]carbamate (PubChem CID 91987645) has the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,3R,4R,5R)-2,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R,3R,4R,5R)-2,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]carbamate |
|---|---|
| PubChem CID | 91987645 |
| Molecular Formula | C11H19NO6 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | tert-butyl N-[(1R,2R,3R,4R,5R)-2,4-dihydroxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1[C@@H](O)[C@H]2CO[C@H](O2)[C@@H]1O |
| InChI | InChI=1S/C11H19NO6/c1-11(2,3)18-10(15)12-6-7(13)5-4-16-9(17-5)8(6)14/h5-9,13-14H,4H2,1-3H3,(H,12,15)/t5-,6-,7+,8-,9-/m1/s1 |
| InChIKey | FWEPONRAYCDQOX-SYHAXYEDSA-N |
| XLogP | -0.64 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |