C10H12O3 — CID 91989828
(3aS,7aS)-3a-methoxy-2,3,7,7a-tetrahydroindene-1,6-dione (PubChem CID 91989828) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (3aS,7aS)-3a-methoxy-2,3,7,7a-tetrahydroindene-1,6-dione.
| Compound Name | (3aS,7aS)-3a-methoxy-2,3,7,7a-tetrahydroindene-1,6-dione |
|---|---|
| PubChem CID | 91989828 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (3aS,7aS)-3a-methoxy-2,3,7,7a-tetrahydroindene-1,6-dione |
| SMILES | CO[C@@]12C=CC(=O)C[C@@H]1C(=O)CC2 |
| InChI | InChI=1S/C10H12O3/c1-13-10-4-2-7(11)6-8(10)9(12)3-5-10/h2,4,8H,3,5-6H2,1H3/t8-,10-/m1/s1 |
| InChIKey | TVOITXYUQYOWSE-PSASIEDQSA-N |
| XLogP | 0.88 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |