About 2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde
2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde (PubChem CID 91990513) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde.
Molecular Properties
| Compound Name | 2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde |
| PubChem CID | 91990513 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde |
| SMILES | CC(C)C1NC(=CC=O)OC1=O |
| InChI | InChI=1S/C8H11NO3/c1-5(2)7-8(11)12-6(9-7)3-4-10/h3-5,7,9H,1-2H3 |
| InChIKey | OCWUJSBIGSLEIV-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde?
The IUPAC name of 2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde (CID 91990513) is 2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde.
What is the SMILES notation for 2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde?
The canonical SMILES for 2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde is CC(C)C1NC(=CC=O)OC1=O.
What is the InChIKey of 2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde?
The InChIKey is OCWUJSBIGSLEIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-5(2)7-8(11)12-6(9-7)3-4-10/h3-5,7,9H,1-2H3.
What are the key properties of 2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde?
2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde has a molecular weight of 169.18 g/mol, XLogP of 0.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-oxo-4-propan-2-yl-1,3-oxazolidin-2-ylidene)acetaldehyde is sourced from PubChem (CID 91990513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).