About N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide
N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide (PubChem CID 91990790) has the molecular formula C9H12N4O3
and a molecular weight of 224.22 g/mol. Its IUPAC name is N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide.
Molecular Properties
| Compound Name | N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide |
| PubChem CID | 91990790 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide |
| SMILES | CC(=O)NN=CCCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C9H12N4O3/c1-7(14)11-10-5-2-6-13-9(16)4-3-8(15)12-13/h3-5H,2,6H2,1H3,(H,11,14)(H,12,15) |
| InChIKey | BFXNMQVWZHJPSV-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide?
The IUPAC name of N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide (CID 91990790) is N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide.
What is the SMILES notation for N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide?
The canonical SMILES for N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide is CC(=O)NN=CCCn1[nH]c(=O)ccc1=O.
What is the InChIKey of N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide?
The InChIKey is BFXNMQVWZHJPSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O3/c1-7(14)11-10-5-2-6-13-9(16)4-3-8(15)12-13/h3-5H,2,6H2,1H3,(H,11,14)(H,12,15).
What are the key properties of N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide?
N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide has a molecular weight of 224.22 g/mol, XLogP of -0.95, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,6-dioxo-1H-pyridazin-2-yl)propylideneamino]acetamide is sourced from PubChem (CID 91990790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).