C20H28N2O6S — CID 9199124
[2-[4-[cyclohexyl(methyl)sulfamoyl]anilino]-2-oxoethyl] 4-oxopentanoate (PubChem CID 9199124) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is [2-[4-[cyclohexyl(methyl)sulfamoyl]anilino]-2-oxoethyl] 4-oxopentanoate.
| Compound Name | [2-[4-[cyclohexyl(methyl)sulfamoyl]anilino]-2-oxoethyl] 4-oxopentanoate |
|---|---|
| PubChem CID | 9199124 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [2-[4-[cyclohexyl(methyl)sulfamoyl]anilino]-2-oxoethyl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OCC(=O)Nc1ccc(S(=O)(=O)N(C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H28N2O6S/c1-15(23)8-13-20(25)28-14-19(24)21-16-9-11-18(12-10-16)29(26,27)22(2)17-6-4-3-5-7-17/h9-12,17H,3-8,13-14H2,1-2H3,(H,21,24) |
| InChIKey | ACVQXSGJBMLIML-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |