C16H22ClN3S — CID 919922
(5R,9S)-2-(4-chlorophenyl)-7,7,9-trimethyl-1,2,4-triazaspiro[4.5]decane-3-thione (PubChem CID 919922) has the molecular formula C16H22ClN3S and a molecular weight of 323.89 g/mol. Its IUPAC name is (5R,9S)-2-(4-chlorophenyl)-7,7,9-trimethyl-1,2,4-triazaspiro[4.5]decane-3-thione.
| Compound Name | (5R,9S)-2-(4-chlorophenyl)-7,7,9-trimethyl-1,2,4-triazaspiro[4.5]decane-3-thione |
|---|---|
| PubChem CID | 919922 |
| Molecular Formula | C16H22ClN3S |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (5R,9S)-2-(4-chlorophenyl)-7,7,9-trimethyl-1,2,4-triazaspiro[4.5]decane-3-thione |
| SMILES | C[C@H]1CC(C)(C)C[C@]2(C1)NC(=S)N(c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C16H22ClN3S/c1-11-8-15(2,3)10-16(9-11)18-14(21)20(19-16)13-6-4-12(17)5-7-13/h4-7,11,19H,8-10H2,1-3H3,(H,18,21)/t11-,16+/m0/s1 |
| InChIKey | XKRBPEGOFCCSIK-MEDUHNTESA-N |
| XLogP | 4.08 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|