C14H30O4 — CID 91997036
5,5-dimethyl-4-propan-2-ylnonane-2,2,8,8-tetrol (PubChem CID 91997036) has the molecular formula C14H30O4 and a molecular weight of 262.39 g/mol. Its IUPAC name is 5,5-dimethyl-4-propan-2-ylnonane-2,2,8,8-tetrol.
| Compound Name | 5,5-dimethyl-4-propan-2-ylnonane-2,2,8,8-tetrol |
|---|---|
| PubChem CID | 91997036 |
| Molecular Formula | C14H30O4 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 5,5-dimethyl-4-propan-2-ylnonane-2,2,8,8-tetrol |
| SMILES | CC(C)C(CC(C)(O)O)C(C)(C)CCC(C)(O)O |
| InChI | InChI=1S/C14H30O4/c1-10(2)11(9-14(6,17)18)12(3,4)7-8-13(5,15)16/h10-11,15-18H,7-9H2,1-6H3 |
| InChIKey | XBFBBUKCPICACJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|