About bis(diethylphosphinic acid);zinc
bis(diethylphosphinic acid);zinc (PubChem CID 91997271) has the molecular formula C8H22O4P2Zn
and a molecular weight of 309.60 g/mol. Its IUPAC name is bis(diethylphosphinic acid);zinc.
Molecular Properties
| Compound Name | bis(diethylphosphinic acid);zinc |
| PubChem CID | 91997271 |
| Molecular Formula | C8H22O4P2Zn |
| Molecular Weight | 309.60 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | bis(diethylphosphinic acid);zinc |
| SMILES | CCP(=O)(O)CC.CCP(=O)(O)CC.[Zn] |
| InChI | InChI=1S/2C4H11O2P.Zn/c2*1-3-7(5,6)4-2;/h2*3-4H2,1-2H3,(H,5,6); |
| InChIKey | YWVIDBKIKUZBNZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(diethylphosphinic acid);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(diethylphosphinic acid);zinc?
The IUPAC name of bis(diethylphosphinic acid);zinc (CID 91997271) is bis(diethylphosphinic acid);zinc.
What is the SMILES notation for bis(diethylphosphinic acid);zinc?
The canonical SMILES for bis(diethylphosphinic acid);zinc is CCP(=O)(O)CC.CCP(=O)(O)CC.[Zn].
What is the InChIKey of bis(diethylphosphinic acid);zinc?
The InChIKey is YWVIDBKIKUZBNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H11O2P.Zn/c2*1-3-7(5,6)4-2;/h2*3-4H2,1-2H3,(H,5,6);.
What are the key properties of bis(diethylphosphinic acid);zinc?
bis(diethylphosphinic acid);zinc has a molecular weight of 309.60 g/mol, XLogP of 2.59, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(diethylphosphinic acid);zinc is sourced from PubChem (CID 91997271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).