About 2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol
2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol (PubChem CID 91997323) has the molecular formula C18H25NO4
and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol |
| PubChem CID | 91997323 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol |
| SMILES | OCCN(CCO)CCO.Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10O.C6H15NO3/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;8-4-1-7(2-5-9)3-6-10/h1-9,13H;8-10H,1-6H2 |
| InChIKey | ZXIKXDFFNVUMQR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol (CID 91997323) is 2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol is OCCN(CCO)CCO.Oc1ccccc1-c1ccccc1.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol?
The InChIKey is ZXIKXDFFNVUMQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C6H15NO3/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;8-4-1-7(2-5-9)3-6-10/h1-9,13H;8-10H,1-6H2.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol?
2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol has a molecular weight of 319.40 g/mol, XLogP of 1.32, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;2-phenylphenol is sourced from PubChem (CID 91997323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).