C24H50S5 — CID 91997890
5-(2,3,4,4,5,5-hexamethylhexan-2-ylpentasulfanyl)-2,2,3,3,4,5-hexamethylhexane (PubChem CID 91997890) has the molecular formula C24H50S5 and a molecular weight of 499.00 g/mol. Its IUPAC name is 5-(2,3,4,4,5,5-hexamethylhexan-2-ylpentasulfanyl)-2,2,3,3,4,5-hexamethylhexane.
| Compound Name | 5-(2,3,4,4,5,5-hexamethylhexan-2-ylpentasulfanyl)-2,2,3,3,4,5-hexamethylhexane |
|---|---|
| PubChem CID | 91997890 |
| Molecular Formula | C24H50S5 |
| Molecular Weight | 499.00 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 5-(2,3,4,4,5,5-hexamethylhexan-2-ylpentasulfanyl)-2,2,3,3,4,5-hexamethylhexane |
| SMILES | CC(C(C)(C)SSSSSC(C)(C)C(C)C(C)(C)C(C)(C)C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H50S5/c1-17(21(9,10)19(3,4)5)23(13,14)25-27-29-28-26-24(15,16)18(2)22(11,12)20(6,7)8/h17-18H,1-16H3 |
| InChIKey | DUSWAJDANSZRTP-UHFFFAOYSA-N |
| XLogP | 11.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.00 |
| LogP ≤ 5 | 11.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|