C24H24F2O2 — CID 91999056
(3E,7E)-1,10-bis(4-fluorophenyl)-3,8-dimethyldeca-3,7-diene-1,10-dione (PubChem CID 91999056) has the molecular formula C24H24F2O2 and a molecular weight of 382.45 g/mol. Its IUPAC name is (3E,7E)-1,10-bis(4-fluorophenyl)-3,8-dimethyldeca-3,7-diene-1,10-dione.
| Compound Name | (3E,7E)-1,10-bis(4-fluorophenyl)-3,8-dimethyldeca-3,7-diene-1,10-dione |
|---|---|
| PubChem CID | 91999056 |
| Molecular Formula | C24H24F2O2 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (3E,7E)-1,10-bis(4-fluorophenyl)-3,8-dimethyldeca-3,7-diene-1,10-dione |
| SMILES | C/C(=C\CC/C=C(\C)CC(=O)c1ccc(F)cc1)CC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H24F2O2/c1-17(15-23(27)19-7-11-21(25)12-8-19)5-3-4-6-18(2)16-24(28)20-9-13-22(26)14-10-20/h5-14H,3-4,15-16H2,1-2H3/b17-5+,18-6+ |
| InChIKey | YELLFSZANPQNOM-QJZPKIEXSA-N |
| XLogP | 6.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|