About [1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium
[1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium (PubChem CID 91999412) has the molecular formula C22H34Br2N2+2
and a molecular weight of 486.34 g/mol. Its IUPAC name is [1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium.
Molecular Properties
| Compound Name | [1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium |
| PubChem CID | 91999412 |
| Molecular Formula | C22H34Br2N2+2 |
| Molecular Weight | 486.34 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | [1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium |
| SMILES | C=CC[N+](CC=C)(CC=C)C(Br)C=CC(Br)[N+](CC=C)(CC=C)CC=C |
| InChI | InChI=1S/C22H34Br2N2/c1-7-15-25(16-8-2,17-9-3)21(23)13-14-22(24)26(18-10-4,19-11-5)20-12-6/h7-14,21-22H,1-6,15-20H2/q+2 |
| InChIKey | VTQFAUYVTIEFPU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.34 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium?
The IUPAC name of [1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium (CID 91999412) is [1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium.
What is the SMILES notation for [1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium?
The canonical SMILES for [1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium is C=CC[N+](CC=C)(CC=C)C(Br)C=CC(Br)[N+](CC=C)(CC=C)CC=C.
What is the InChIKey of [1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium?
The InChIKey is VTQFAUYVTIEFPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34Br2N2/c1-7-15-25(16-8-2,17-9-3)21(23)13-14-22(24)26(18-10-4,19-11-5)20-12-6/h7-14,21-22H,1-6,15-20H2/q+2.
What are the key properties of [1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium?
[1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium has a molecular weight of 486.34 g/mol, XLogP of 5.73, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [1,4-dibromo-4-[tris(prop-2-enyl)azaniumyl]but-2-enyl]-tris(prop-2-enyl)azanium is sourced from PubChem (CID 91999412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).