C20H23ClN2O3S — CID 9200582
[2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 2-chloro-5-methylsulfanylbenzoate (PubChem CID 9200582) has the molecular formula C20H23ClN2O3S and a molecular weight of 406.94 g/mol. Its IUPAC name is [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 2-chloro-5-methylsulfanylbenzoate.
| Compound Name | [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 2-chloro-5-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 9200582 |
| Molecular Formula | C20H23ClN2O3S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [2-[[4-(dimethylamino)phenyl]methyl-methylamino]-2-oxoethyl] 2-chloro-5-methylsulfanylbenzoate |
| SMILES | CSc1ccc(Cl)c(C(=O)OCC(=O)N(C)Cc2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C20H23ClN2O3S/c1-22(2)15-7-5-14(6-8-15)12-23(3)19(24)13-26-20(25)17-11-16(27-4)9-10-18(17)21/h5-11H,12-13H2,1-4H3 |
| InChIKey | CVZHEUPGTZUSDQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|