C13H7BrClN3O3S — CID 9201725
[5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate (PubChem CID 9201725) has the molecular formula C13H7BrClN3O3S and a molecular weight of 400.64 g/mol. Its IUPAC name is [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate.
| Compound Name | [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 9201725 |
| Molecular Formula | C13H7BrClN3O3S |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 398.91 |
| IUPAC Name | [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate |
| SMILES | O=C(OCc1nnc(-c2ccc(Br)s2)o1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H7BrClN3O3S/c14-9-3-2-8(22-9)12-18-17-11(21-12)6-20-13(19)7-1-4-10(15)16-5-7/h1-5H,6H2 |
| InChIKey | HIDDXAHDWPWGBV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|