About [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate
[5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate (PubChem CID 9201725) has the molecular formula C13H7BrClN3O3S
and a molecular weight of 400.64 g/mol. Its IUPAC name is [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate.
Molecular Properties
| Compound Name | [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate |
| PubChem CID | 9201725 |
| Molecular Formula | C13H7BrClN3O3S |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 398.91 |
| IUPAC Name | [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate |
| SMILES | O=C(OCc1nnc(-c2ccc(Br)s2)o1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H7BrClN3O3S/c14-9-3-2-8(22-9)12-18-17-11(21-12)6-20-13(19)7-1-4-10(15)16-5-7/h1-5H,6H2 |
| InChIKey | HIDDXAHDWPWGBV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate?
The IUPAC name of [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate (CID 9201725) is [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate.
What is the SMILES notation for [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate?
The canonical SMILES for [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate is O=C(OCc1nnc(-c2ccc(Br)s2)o1)c1ccc(Cl)nc1.
What is the InChIKey of [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate?
The InChIKey is HIDDXAHDWPWGBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrClN3O3S/c14-9-3-2-8(22-9)12-18-17-11(21-12)6-20-13(19)7-1-4-10(15)16-5-7/h1-5H,6H2.
What are the key properties of [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate?
[5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate has a molecular weight of 400.64 g/mol, XLogP of 3.97, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(5-bromothiophen-2-yl)-1,3,4-oxadiazol-2-yl]methyl 6-chloropyridine-3-carboxylate is sourced from PubChem (CID 9201725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).