C14H16N8O — CID 920294
N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 920294) has the molecular formula C14H16N8O and a molecular weight of 312.34 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 920294 |
| Molecular Formula | C14H16N8O |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | Cc1cc(C)n2nc(C(=O)NN=Cc3cn(C)nc3C)nc2n1 |
| InChI | InChI=1S/C14H16N8O/c1-8-5-9(2)22-14(16-8)17-12(20-22)13(23)18-15-6-11-7-21(4)19-10(11)3/h5-7H,1-4H3,(H,18,23) |
| InChIKey | XUZXAGPFVMTMIR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|