C15H16Cl2N2O4 — CID 9203023
[2-[(2S)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 2,5-dichlorobenzoate (PubChem CID 9203023) has the molecular formula C15H16Cl2N2O4 and a molecular weight of 359.21 g/mol. Its IUPAC name is [2-[(2S)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 2,5-dichlorobenzoate.
| Compound Name | [2-[(2S)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 9203023 |
| Molecular Formula | C15H16Cl2N2O4 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | [2-[(2S)-2-carbamoylpiperidin-1-yl]-2-oxoethyl] 2,5-dichlorobenzoate |
| SMILES | NC(=O)[C@@H]1CCCCN1C(=O)COC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H16Cl2N2O4/c16-9-4-5-11(17)10(7-9)15(22)23-8-13(20)19-6-2-1-3-12(19)14(18)21/h4-5,7,12H,1-3,6,8H2,(H2,18,21)/t12-/m0/s1 |
| InChIKey | NLRBJZOKVNSSMJ-LBPRGKRZSA-N |
| XLogP | 2.02 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |