C16H20N8O — CID 920307
N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 920307) has the molecular formula C16H20N8O and a molecular weight of 340.39 g/mol. Its IUPAC name is N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 920307 |
| Molecular Formula | C16H20N8O |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCn1nc(C)c(C=NNC(=O)c2nc3nc(C)cc(C)n3n2)c1C |
| InChI | InChI=1S/C16H20N8O/c1-6-23-12(5)13(11(4)21-23)8-17-20-15(25)14-19-16-18-9(2)7-10(3)24(16)22-14/h7-8H,6H2,1-5H3,(H,20,25) |
| InChIKey | XSDQJJMMGQZIRT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|