About 2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione
2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione (PubChem CID 920374) has the molecular formula C9H17N3S
and a molecular weight of 199.32 g/mol. Its IUPAC name is 2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione.
Molecular Properties
| Compound Name | 2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione |
| PubChem CID | 920374 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione |
| SMILES | CN1NC2(CCCCCC2)NC1=S |
| InChI | InChI=1S/C9H17N3S/c1-12-8(13)10-9(11-12)6-4-2-3-5-7-9/h11H,2-7H2,1H3,(H,10,13) |
| InChIKey | MNWOZFQMBRRSOV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione?
The IUPAC name of 2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione (CID 920374) is 2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione.
What is the SMILES notation for 2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione?
The canonical SMILES for 2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione is CN1NC2(CCCCCC2)NC1=S.
What is the InChIKey of 2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione?
The InChIKey is MNWOZFQMBRRSOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3S/c1-12-8(13)10-9(11-12)6-4-2-3-5-7-9/h11H,2-7H2,1H3,(H,10,13).
What are the key properties of 2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione?
2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione has a molecular weight of 199.32 g/mol, XLogP of 1.36, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,2,4-triazaspiro[4.6]undecane-3-thione is sourced from PubChem (CID 920374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).