About 5H-indeno[1,2-b]pyridine
5H-indeno[1,2-b]pyridine (PubChem CID 9205) has the molecular formula C12H9N
and a molecular weight of 167.21 g/mol. Its IUPAC name is 5H-indeno[1,2-b]pyridine.
Molecular Properties
| Compound Name | 5H-indeno[1,2-b]pyridine |
| PubChem CID | 9205 |
| Molecular Formula | C12H9N |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 5H-indeno[1,2-b]pyridine |
| SMILES | c1ccc2c(c1)Cc1cccnc1-2 |
| InChI | InChI=1S/C12H9N/c1-2-6-11-9(4-1)8-10-5-3-7-13-12(10)11/h1-7H,8H2 |
| InChIKey | FWEHZHRUCQRSJP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5H-indeno[1,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-indeno[1,2-b]pyridine?
The IUPAC name of 5H-indeno[1,2-b]pyridine (CID 9205) is 5H-indeno[1,2-b]pyridine.
What is the SMILES notation for 5H-indeno[1,2-b]pyridine?
The canonical SMILES for 5H-indeno[1,2-b]pyridine is c1ccc2c(c1)Cc1cccnc1-2.
What is the InChIKey of 5H-indeno[1,2-b]pyridine?
The InChIKey is FWEHZHRUCQRSJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N/c1-2-6-11-9(4-1)8-10-5-3-7-13-12(10)11/h1-7H,8H2.
What are the key properties of 5H-indeno[1,2-b]pyridine?
5H-indeno[1,2-b]pyridine has a molecular weight of 167.21 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-indeno[1,2-b]pyridine is sourced from PubChem (CID 9205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).