C16H24N4O3S — CID 9205651
2-[methyl-[(E)-2-phenylethenyl]sulfonylamino]-N-(4-methylpiperazin-1-yl)acetamide (PubChem CID 9205651) has the molecular formula C16H24N4O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-[methyl-[(E)-2-phenylethenyl]sulfonylamino]-N-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | 2-[methyl-[(E)-2-phenylethenyl]sulfonylamino]-N-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 9205651 |
| Molecular Formula | C16H24N4O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[methyl-[(E)-2-phenylethenyl]sulfonylamino]-N-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CN1CCN(NC(=O)CN(C)S(=O)(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C16H24N4O3S/c1-18-9-11-20(12-10-18)17-16(21)14-19(2)24(22,23)13-8-15-6-4-3-5-7-15/h3-8,13H,9-12,14H2,1-2H3,(H,17,21)/b13-8+ |
| InChIKey | RQHWNLXZXREOEB-MDWZMJQESA-N |
| XLogP | 0.20 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |